AB43735
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $8.00 | $5.00 | - + | |
5g | 98% | in stock | $10.00 | $7.00 | - + | |
25g | 98% | in stock | $42.00 | $29.00 | - + | |
100g | 98% | in stock | $165.00 | $115.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB43735 |
Chemical Name: | 2,7-Dibromo-9H-carbazole |
CAS Number: | 136630-39-2 |
Molecular Formula: | C12H7Br2N |
Molecular Weight: | 324.9987 |
MDL Number: | MFCD09033507 |
SMILES: | Brc1ccc2c(c1)[nH]c1c2ccc(c1)Br |
Complexity: | 222 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 4.8 |
2,7-Dibromo-9H-Carbazole is a versatile compound that finds extensive use in chemical synthesis processes. As a highly reactive intermediate, this compound exhibits a wide range of applications in organic chemistry. One notable use of 2,7-Dibromo-9H-Carbazole is in the synthesis of various functionalized carbazoles and related heterocyclic compounds. Due to its unique structure and reactivity, this compound serves as a key building block for the construction of complex organic molecules. By employing 2,7-Dibromo-9H-Carbazole as a starting material, chemists can access a diverse array of derivatives through various synthetic routes, enabling the efficient preparation of novel compounds with potentially valuable properties in pharmaceuticals, materials science, and other fields.
Acta crystallographica. Section E, Structure reports online 20081101