AA50266
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $7.00 | $5.00 | - + | |
5g | 97% | in stock | $15.00 | $11.00 | - + | |
25g | 98% | in stock | $53.00 | $38.00 | - + | |
100g | 98% | in stock | $171.00 | $120.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA50266 |
Chemical Name: | 4-Oxo-1,4-dihydroquinoline-3-carboxylic acid |
CAS Number: | 13721-01-2 |
Molecular Formula: | C10H7NO3 |
Molecular Weight: | 189.1675 |
MDL Number: | MFCD00498984 |
SMILES: | OC(=O)c1c[nH]c2c(c1=O)cccc2 |
NSC Number: | 4344 |
Complexity: | 309 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.8 |
ChemMedChem 20120501
Journal of pharmacy & pharmaceutical sciences : a publication of the Canadian Society for Pharmaceutical Sciences, Societe canadienne des sciences pharmaceutiques 20120101
Bioorganic & medicinal chemistry letters 20111001
Journal of medicinal chemistry 20110811
Bioorganic & medicinal chemistry letters 20101101
Journal of medicinal chemistry 20100826
ChemMedChem 20100705
European journal of medicinal chemistry 20100501
Acta crystallographica. Section E, Structure reports online 20091101
Current medicinal chemistry 20090101
Molecules (Basel, Switzerland) 20081118
Journal of medicinal chemistry 20080828
Journal of medicinal chemistry 20080828
Bioorganic & medicinal chemistry 20080715
Molecules (Basel, Switzerland) 20070727
Journal of medicinal chemistry 20061102
Journal of medicinal chemistry 20050505