AB46635
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25g | 97% | in stock | $9.00 | $6.00 | - + | |
100g | 97% | in stock | $15.00 | $10.00 | - + | |
500g | 97% | in stock | $55.00 | $39.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46635 |
Chemical Name: | Boc-Val-OH |
CAS Number: | 13734-41-3 |
Molecular Formula: | C10H19NO4 |
Molecular Weight: | 217.26216 |
MDL Number: | MFCD00065605 |
SMILES: | O=C(OC(C)(C)C)N[C@H](C(=O)O)C(C)C |
Complexity: | 242 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
XLogP3: | 1.5 |
Boc-Val-OH, also known as N-(tert-butoxycarbonyl)-L-valine, is a key compound widely used in chemical synthesis. As a versatile building block in organic chemistry, Boc-Val-OH is commonly employed in the synthesis of peptides and various pharmaceuticals.In peptide synthesis, Boc-Val-OH serves as a crucial amino acid derivative for the construction of peptide chains. Its Boc (tert-butoxycarbonyl) protecting group provides stability to the amino acid residue during chemical reactions, allowing for selective deprotection and successive coupling steps without compromising the integrity of the peptide sequence. This controlled release of the amino acid ensures the successful formation of complex peptide structures with high purity and yield.Additionally, Boc-Val-OH plays a significant role in the preparation of pharmaceutical compounds. Its utilization in the chemical synthesis of drug candidates enables the efficient incorporation of valine residues into target molecules, facilitating the development of bioactive compounds with enhanced pharmacological properties. By incorporating Boc-Val-OH into the synthetic pathway, chemists can tailor the structure and properties of pharmaceutical compounds, thereby advancing research in drug discovery and development.Overall, Boc-Val-OH's application in chemical synthesis underscores its importance as a fundamental building block in the creation of peptides and pharmaceuticals. Its versatility and reliability make it an indispensable tool for organic chemists seeking to design and construct novel molecules with tailored functionalities and biological activities.
Biomacromolecules 20101213
The Journal of organic chemistry 20091002
The journal of peptide research : official journal of the American Peptide Society 20051001
Bioorganic & medicinal chemistry letters 20021202