AE63749
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10mg | 98% | 2 weeks | $543.00 | $380.00 | - + | |
25mg | 98% | 2 weeks | $862.00 | $603.00 | - + | |
50mg | 98% | 2 weeks | $1,248.00 | $874.00 | - + | |
100mg | 98% | 2 weeks | $1,853.00 | $1,298.00 | - + | |
250mg | 98% | 2 weeks | $3,164.00 | $2,215.00 | - + | |
500mg | 98% | 2 weeks | $4,576.00 | $3,203.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE63749 |
Chemical Name: | (S)-2-Amino-3-(4-(2-amino-6-((R)-1-(4-chloro-2-(3-methyl-1H-pyrazol-1-yl)phenyl)-2,2,2-trifluoroethoxy)pyrimidin-4-yl)phenyl)propanoic acid compound with benzenesulfonic acid (1:1) |
CAS Number: | 1374745-52-4 |
Molecular Formula: | C31H28ClF3N6O6S |
Molecular Weight: | 705.1038 |
MDL Number: | MFCD30803020 |
SMILES: | OS(=O)(=O)c1ccccc1.Nc1nc(cc(n1)c1ccc(cc1)C[C@@H](C(=O)O)N)O[C@@H](C(F)(F)F)c1ccc(cc1n1ccc(n1)C)Cl |