logo
Home  > Chemistry  > Catalysis Chemistry  > Metal Catalysts  > Chloro[(tri-tert-butylphosphine)-2-(2-aminobiphenyl)]palladium(ii)

AA50996

1375325-71-5 | Chloro[(tri-tert-butylphosphine)-2-(2-aminobiphenyl)]palladium(ii)

Packsize Purity Availability Price Discounted Price    Quantity
100mg 97% in stock $10.00 $7.00 -   +
250mg 97% in stock $13.00 $9.00 -   +
1g 97% in stock $33.00 $24.00 -   +
5g 97% in stock $146.00 $103.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA50996
Chemical Name: Chloro[(tri-tert-butylphosphine)-2-(2-aminobiphenyl)]palladium(ii)
CAS Number: 1375325-71-5
Molecular Formula: C24H37ClNPPd
Molecular Weight: 512.4040409999999
MDL Number: MFCD21608496
SMILES: CC(P([Pd+2]1([Cl-])Nc2ccccc2C2=CC=CC=[C-]12)(C(C)(C)C)C(C)(C)C)(C)C

 

Computed Properties
Complexity: 399  
Covalently-Bonded Unit Count: 3  
Heavy Atom Count: 28  
Hydrogen Bond Acceptor Count: 2  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 4  

 

 

Upstream Synthesis Route
  • Chloro[(tri-tert-butylphosphine)-2-(2-aminobiphenyl)] palladium(II) is a versatile catalyst used in chemical synthesis processes. This complex plays a crucial role in various organic transformations, serving as a powerful tool in the formation of new carbon-carbon and carbon-nitrogen bonds. The unique structure of this catalyst allows for selective activation of specific bonds, enabling precise control over the desired reactions. With its high efficiency and reactivity, Chloro[(tri-tert-butylphosphine)-2-(2-aminobiphenyl)] palladium(II) is widely employed in the synthesis of pharmaceuticals, agrochemicals, and advanced materials. Its ability to catalyze challenging cross-coupling reactions and functionalize complex molecules makes it an indispensable component in modern synthetic chemistry strategies.
FEATURED PRODUCTS