BI34018
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 97% | 1 week | $221.00 | $155.00 | - + | |
50mg | 97% | 1 week | $395.00 | $277.00 | - + | |
100mg | 97% | 1 week | $710.00 | $497.00 | - + | |
250mg | 97% | 1 week | $1,419.00 | $994.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BI34018 |
Chemical Name: | 4-(((3-(3-Ethyl-1-methylazepan-3-yl)phenoxy)carbonyl)amino)benzoic acid compound with maleic acid 1:1 |
CAS Number: | 1383608-60-3 |
Molecular Formula: | C27H32N2O8 |
Molecular Weight: | 512.5516 |
SMILES: | OC(=O)C=CC(=O)O.CCC1(CCCCN(C1)C)c1cccc(c1)OC(=O)Nc1ccc(cc1)C(=O)O |