logo
Home  > Chemistry  > Organic Building Blocks  > Sulfonates  > 1-(tert-Butoxycarbonyl)-1,2,3,6-tetrahydropyridin-4-yl trifluoromethanesulfonate

AD54530

138647-49-1 | 1-(tert-Butoxycarbonyl)-1,2,3,6-tetrahydropyridin-4-yl trifluoromethanesulfonate

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $13.00 $9.00 -   +
1g 95% in stock $18.00 $13.00 -   +
5g 95% in stock $31.00 $22.00 -   +
10g 95% in stock $61.00 $43.00 -   +
25g 95% in stock $152.00 $107.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AD54530
Chemical Name: 1-(tert-Butoxycarbonyl)-1,2,3,6-tetrahydropyridin-4-yl trifluoromethanesulfonate
CAS Number: 138647-49-1
Molecular Formula: C11H16F3NO5S
Molecular Weight: 331.30864959999997
MDL Number: MFCD09997858
SMILES: O=C(N1CCC(=CC1)OS(=O)(=O)C(F)(F)F)OC(C)(C)C

 

Computed Properties
Complexity: 528  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 21  
Hydrogen Bond Acceptor Count: 8  
Rotatable Bond Count: 4  
XLogP3: 2.3  

 

 

Upstream Synthesis Route
  • The 1(2H)-pyridinecarboxylic acid, 3,6-dihydro-4-[[trifluoromethyl)sulfonyl]oxy]-, 1,1-dimethylethyl ester is a versatile compound widely used in chemical synthesis as a reagent for introducing the trifluoromethylsulfonyl group into organic molecules. This specific ester plays a crucial role in the synthesis of various pharmaceuticals, agrochemicals, and materials due to the unique properties imparted by the trifluoromethylsulfonyl moiety. Its ability to act as a strong electrophile makes it valuable for functionalizing organic molecules, enabling the formation of new carbon-carbon and carbon-heteroatom bonds. Additionally, the 1(2H)-pyridinecarboxylic acid ester enhances the stability and lipophilicity of the resulting compounds, making them potentially useful in drug discovery and development processes.
FEATURED PRODUCTS