AV36503
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | 1 week | $371.00 | $260.00 | - + | |
100mg | 95% | 1 week | $511.00 | $358.00 | - + | |
250mg | 95% | 1 week | $695.00 | $486.00 | - + | |
500mg | 95% | 1 week | $1,048.00 | $733.00 | - + | |
1g | 95% | 1 week | $1,321.00 | $925.00 | - + | |
2.5g | 95% | 1 week | $2,515.00 | $1,760.00 | - + | |
5g | 95% | 1 week | $3,684.00 | $2,579.00 | - + | |
10g | 95% | 1 week | $5,419.00 | $3,794.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AV36503 |
Chemical Name: | 3-ethyl-1-(propane-2-sulfonyl)piperidin-4-amine, Mixture of diastereomers |
CAS Number: | 1394042-62-6 |
Molecular Formula: | C10H22N2O2S |
Molecular Weight: | 234.3589 |
MDL Number: | MFCD22378806 |
SMILES: | CCC1CN(CCC1N)S(=O)(=O)C(C)C |