AX35086
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10mg | 97% | in stock | $46.00 | $32.00 | - + | |
25mg | 97% | in stock | $56.00 | $40.00 | - + | |
50mg | 97% | in stock | $67.00 | $47.00 | - + | |
100mg | 97% | in stock | $82.00 | $57.00 | - + | |
250mg | 97% | in stock | $145.00 | $102.00 | - + | |
1g | 97% | in stock | $247.00 | $173.00 | - + | |
5g | 97% | in stock | $864.00 | $605.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX35086 |
Chemical Name: | Fmoc-Val-Ala-PAB |
CAS Number: | 1394238-91-5 |
Molecular Formula: | C30H33N3O5 |
Molecular Weight: | 515.6001 |
MDL Number: | MFCD28557282 |
SMILES: | OCc1ccc(cc1)NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)OCC1c2ccccc2-c2c1cccc2)C |
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-valyl-N-[4-(hydroxymethyl)phenyl]-L-alaninamide is a versatile compound widely utilized in chemical synthesis. Its unique chemical structure allows for precise control in the formation of complex molecules through various synthetic pathways. This compound serves as a valuable building block in peptide synthesis, enabling the creation of custom peptides with specific sequences and functionalities. Additionally, its reactivity and stability make it an essential tool in the design and production of pharmaceuticals, agrochemicals, and advanced materials.