AB46297
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100g | 98% | in stock | $11.00 | $8.00 | - + | |
500g | 98% | in stock | $29.00 | $21.00 | - + | |
1000g | 98% | in stock | $48.00 | $34.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46297 |
Chemical Name: | Iron(III) acetylacetonate |
CAS Number: | 14024-18-1 |
Molecular Formula: | C15H21FeO6 |
Molecular Weight: | 353.1686399999999 |
MDL Number: | MFCD00000020 |
SMILES: | CC1=[O][Fe+3]23([O]=C([CH-]1)C)([O]=C(C)[CH-]C(=[O]2)C)[O]=C(C)[CH-]C(=[O]3)C |
Complexity: | 380 |
Covalently-Bonded Unit Count: | 4 |
Defined Bond Stereocenter Count: | 3 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 3 |
In chemical synthesis, Iron, tris(2,4-pentanedionato-κO2,κO4)-(OC-6-11)- serves as a versatile catalyst that facilitates various transformations. Its unique structure allows it to engage in coordination chemistry, promoting numerous organic reactions such as oxidation, reduction, and C-C bond formation. This compound has found application in the production of complex organic molecules, pharmaceutical intermediates, and fine chemicals. By harnessing the reactivity of Iron tris(2,4-pentanedionato), chemists can streamline synthetic pathways, improve yields, and enhance overall efficiency in the laboratory.