AI34231
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $16.00 | $12.00 | - + | |
250mg | 95% | in stock | $39.00 | $28.00 | - + | |
1g | 98% | in stock | $144.00 | $101.00 | - + | |
5g | ≥95% | in stock | $700.00 | $490.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI34231 |
Chemical Name: | (2R,5R)-tert-Butyl 5-(hydroxymethyl)-2-methylpiperazine-1-carboxylate |
CAS Number: | 1403898-64-5 |
Molecular Formula: | C11H22N2O3 |
Molecular Weight: | 230.3040 |
MDL Number: | MFCD28100885 |
SMILES: | OC[C@@H]1NC[C@H](N(C1)C(=O)OC(C)(C)C)C |
Complexity: | 250 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 0.3 |
The synthesis of (2R,5R)-tert-Butyl 5-(hydroxymethyl)-2-methylpiperazine-1-carboxylate can be accomplished through the following steps: 1. Start with the chiral pool synthesis or resolution of racemic mixtures to obtain the enantiomerically pure (2R,5R)-2-methylpiperazine. This can typically be achieved by enantioselective hydrogenation or using chiral catalysts. 2. Protect the amine functionalities of the (2R,5R)-2-methylpiperazine by reacting it with tert-butyl dicarbonate (Boc-anhydride) in the presence of a suitable base like triethylamine to yield the corresponding (2R,5R)-di-tert-butyl protected piperazine. 3. Introduce the hydroxymethyl group at the 5-position via nucleophilic substitution. React the protected piperazine with formaldehyde and a reducing agent such as sodium cyanoborohydride (NaBH3CN) or sodium borohydride (NaBH4) in a reductive amination reaction. 4. Protect the hydroxymethyl group as needed for downstream functionalization or leave it free depending on the next synthetic steps and the desired final product protection strategy. 5. Purify the final compound (2R,5R)-tert-Butyl 5-(hydroxymethyl)-2-methylpiperazine-1-carboxylate using appropriate chromatographic techniques to ensure the proper stereochemistry and purity of the compound.