AA62690
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $203.00 | $142.00 | - + | |
5g | 95% | in stock | $573.00 | $402.00 | - + | |
10g | 95% | in stock | $946.00 | $662.00 | - + | |
25g | 95% | in stock | $1,879.00 | $1,316.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA62690 |
Chemical Name: | 1-[(4-Methoxyphenyl)methyl]pyrrole-2,5-dione |
CAS Number: | 140480-96-2 |
Molecular Formula: | C12H11NO3 |
Molecular Weight: | 217.2206 |
MDL Number: | MFCD00113970 |
SMILES: | COc1ccc(cc1)CN1C(=O)C=CC1=O |
Complexity: | 298 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 3 |
XLogP3: | 0.9 |
Journal of medicinal chemistry 20051117