AE35992
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $10.00 | $7.00 | - + | |
5mg | 98% | in stock | $23.00 | $17.00 | - + | |
10mg | 98% | in stock | $34.00 | $24.00 | - + | |
25mg | 98% | in stock | $57.00 | $40.00 | - + | |
50mg | 98% | in stock | $96.00 | $68.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE35992 |
Chemical Name: | TG6-10-1 |
CAS Number: | 1415716-58-3 |
Molecular Formula: | C23H23F3N2O4 |
Molecular Weight: | 448.4349 |
MDL Number: | MFCD29472234 |
SMILES: | COc1cc(/C=C/C(=O)NCCn2c3ccccc3cc2C(F)(F)F)cc(c1OC)OC |
Complexity: | 631 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 32 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 8 |
XLogP3: | 4.2 |
European journal of medicinal chemistry 20140723
Journal of clinical microbiology 19751201