AA68080
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $6.00 | $4.00 | - + | |
10mg | 95% | in stock | $7.00 | $5.00 | - + | |
25mg | 95% | in stock | $9.00 | $6.00 | - + | |
50mg | 95% | in stock | $11.00 | $8.00 | - + | |
250mg | 95% | in stock | $14.00 | $10.00 | - + | |
1g | 95% | in stock | $33.00 | $23.00 | - + | |
5g | 95% | in stock | $93.00 | $65.00 | - + | |
10g | 95% | in stock | $160.00 | $112.00 | - + | |
25g | 95% | in stock | $320.00 | $224.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA68080 |
Chemical Name: | Dronedarone, HCl |
CAS Number: | 141625-93-6 |
Molecular Formula: | C31H45ClN2O5S |
Molecular Weight: | 593.2174 |
MDL Number: | MFCD00914940 |
SMILES: | CCCCc1oc2c(c1C(=O)c1ccc(cc1)OCCCN(CCCC)CCCC)cc(cc2)NS(=O)(=O)C.Cl |
Complexity: | 800 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 40 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 18 |
European journal of medicinal chemistry 20140623