BL34194
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | 1 week | $770.00 | $539.00 | - + | |
100mg | 95% | 1 week | $1,110.00 | $777.00 | - + | |
250mg | 95% | 1 week | $1,548.00 | $1,084.00 | - + | |
500mg | 95% | 1 week | $2,399.00 | $1,679.00 | - + | |
1g | 95% | 1 week | $3,051.00 | $2,136.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BL34194 |
Chemical Name: | 6-{[(tert-butyldimethylsilyl)oxy]methyl}oxan-3-ol, Mixture of diastereomers |
CAS Number: | 1429421-71-5 |
Molecular Formula: | C12H26O3Si |
Molecular Weight: | 246.4185 |
MDL Number: | MFCD28402859 |
SMILES: | OC1CCC(OC1)CO[Si](C(C)(C)C)(C)C |