AE35573
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $20.00 | $14.00 | - + | |
5mg | 98% | in stock | $38.00 | $26.00 | - + | |
10mg | 98% | in stock | $52.00 | $36.00 | - + | |
50mg | 98% | in stock | $128.00 | $89.00 | - + | |
100mg | 98% | in stock | $195.00 | $136.00 | - + | |
250mg | 98% | in stock | $333.00 | $233.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE35573 |
Chemical Name: | 1-[5-(Cyclopropylsulfamoyl)-2-(thiophen-3-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
CAS Number: | 1432660-47-3 |
Molecular Formula: | C21H18F3N3O3S2 |
Molecular Weight: | 481.5111 |
MDL Number: | MFCD26097285 |
SMILES: | O=C(Nc1cc(ccc1c1ccsc1)S(=O)(=O)NC1CC1)Nc1cccc(c1)C(F)(F)F |
Complexity: | 771 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 32 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 6 |
XLogP3: | 4.2 |
The Journal of biological chemistry 20150109