AB58307
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $8.00 | $5.00 | - + | |
10g | 98% | in stock | $9.00 | $6.00 | - + | |
25g | 98% | in stock | $12.00 | $9.00 | - + | |
100g | 98% | in stock | $48.00 | $34.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB58307 |
Chemical Name: | 1-Ethyl-3-methylimidazolium tetrafluoroborate |
CAS Number: | 143314-16-3 |
Molecular Formula: | C6H11BF4N2 |
Molecular Weight: | 197.9696 |
MDL Number: | MFCD00216668 |
SMILES: | F[B-](F)(F)F.CCn1cc[n+](c1)C |
Complexity: | 92 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 1 |
1-Ethyl-3-methyl-1H-imidazol-3-ium tetrafluoroborate is a versatile compound widely used in chemical synthesis due to its unique properties. This compound serves as an effective ionic liquid catalyst in various organic reactions, including coupling reactions, oxidation reactions, and hydrogenation processes. Additionally, it is utilized as a phase transfer catalyst, enabling the transfer of reactants between immiscible phases during synthesis. Its high thermal stability and solubility in organic solvents make it an ideal choice for promoting a wide range of chemical transformations in the laboratory. This compound plays a crucial role in facilitating complex reactions and enhancing the efficiency of synthetic procedures in organic chemistry.
Bioresource technology 20121001
Journal of molecular modeling 20120401
Faraday discussions 20120101
Chemosphere 20110901
Biomedical chromatography : BMC 20110501
Microscopy research and technique 20110501
Yao xue xue bao = Acta pharmaceutica Sinica 20101001
Bioelectrochemistry (Amsterdam, Netherlands) 20090601
The journal of physical chemistry. B 20090416
Electrophoresis 20080501
Angewandte Chemie (International ed. in English) 20080101
ChemSusChem 20080101
Electrophoresis 20071201
Journal of separation science 20070601
Journal of chromatography. A 20060901
Journal of pharmaceutical and biomedical analysis 20060411
Biomedical chromatography : BMC 20050101
Magnetic resonance in chemistry : MRC 20040101