AD19776
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $25.00 | $17.00 | - + | |
5g | 95% | in stock | $52.00 | $36.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD19776 |
Chemical Name: | 4-Benzyloxy-3-nitroacetophenone |
CAS Number: | 14347-05-8 |
Molecular Formula: | C15H13NO4 |
Molecular Weight: | 271.268 |
MDL Number: | MFCD02258926 |
SMILES: | [O-][N+](=O)c1cc(ccc1OCc1ccccc1)C(=O)C |
Complexity: | 346 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 4 |
XLogP3: | 2.9 |
The compound 1-(4-(Benzyloxy)-3-nitrophenyl)ethanone is a versatile chemical reagent that finds widespread application in organic synthesis. Its strategic molecular structure, featuring a benzyl ether and a nitro group attached to a phenyl ring connected to an ethanone moiety, provides several opportunities for functional group interconversions and selective transformations. In chemical synthesis, this compound serves as a valuable building block for the construction of complex organic molecules due to its ability to participate in various reactions such as nucleophilic substitutions, reductions, and cross-coupling reactions. Additionally, the presence of the nitro group can facilitate further derivatization through reduction to the corresponding amine or conversion to other functional groups, enabling the synthesis of diverse chemical entities with tailored properties.