AA70901
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $12.00 | $9.00 | - + | |
1g | 97% | in stock | $20.00 | $14.00 | - + | |
5g | 97% | in stock | $39.00 | $27.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA70901 |
Chemical Name: | (4-Formyl-phenyl)-carbamic acid tert-butyl ester |
CAS Number: | 144072-30-0 |
Molecular Formula: | C12H15NO3 |
Molecular Weight: | 221.2524 |
MDL Number: | MFCD28368998 |
SMILES: | O=Cc1ccc(cc1)NC(=O)OC(C)(C)C |
Complexity: | 250 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 1.9 |
The tert-Butyl 4-formylphenylcarbamate, or commonly known as $name$, serves as a valuable tool in chemical synthesis due to its versatile reactivity and functionality. This compound is frequently employed as a key building block in the preparation of various organic compounds, particularly in the field of medicinal chemistry and pharmaceuticals.One notable application of $name$ is its utility as a protecting group for amines in organic synthesis. By selectively masking the amino groups, $name$ enables chemists to carry out specific reactions without interfering with other functional groups present in the molecule. This strategy is especially valuable in complex synthesis routes where the protection of certain reactive sites is critical to achieving the desired end product.Additionally, $name$ can also act as a precursor for the synthesis of various heterocyclic compounds and bioactive molecules. Its unique structural properties make it a suitable candidate for introducing diversity into molecular libraries and designing new drug candidates with enhanced pharmacological properties.Overall, the versatile reactivity and selective reactivity of tert-Butyl 4-formylphenylcarbamate make it a valuable tool in chemical synthesis, particularly in the development of novel organic compounds with potential applications in drug discovery and other related fields.