AA72969
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $9.00 | $6.00 | - + | |
5g | 95% | in stock | $20.00 | $14.00 | - + | |
10g | 95% | in stock | $33.00 | $23.00 | - + | |
25g | 95% | in stock | $76.00 | $53.00 | - + | |
100g | 95% | in stock | $300.00 | $210.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA72969 |
Chemical Name: | N,N'-Bis-tert-butoxycarbonylthiourea |
CAS Number: | 145013-05-4 |
Molecular Formula: | C11H20N2O4S |
Molecular Weight: | 276.3525 |
MDL Number: | MFCD03093917 |
SMILES: | S=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
Complexity: | 310 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | 3.4 |
N,N'-Bis-tert-butoxycarbonylthiourea, a versatile compound widely employed in chemical synthesis, serves as a valuable reagent in various organic reactions. It plays a crucial role as a protecting group for amines and amino acids, allowing for selective manipulation of functional groups during complex synthetic sequences. This compound is particularly useful in peptide synthesis, where it aids in the stepwise assembly of peptide chains by temporarily blocking specific amine functionalities. Furthermore, N,N'-Bis-tert-butoxycarbonylthiourea is utilized in the preparation of diverse sulfur-containing compounds, such as thioamides and thiohydantoins, showcasing its utility in sulfur chemistry. Its ability to facilitate the formation of intricate molecular structures makes it an indispensable tool in the realm of organic synthesis.