AA63784
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | ≥98% | in stock | $120.00 | $84.00 | - + | |
50mg | ≥98% | in stock | $214.00 | $150.00 | - + | |
100mg | ≥98% | in stock | $376.00 | $263.00 | - + | |
250mg | ≥98% | in stock | $880.00 | $616.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA63784 |
Chemical Name: | Tasosartan |
CAS Number: | 145733-36-4 |
Molecular Formula: | C23H21N7O |
Molecular Weight: | 411.4591 |
MDL Number: | MFCD00865905 |
SMILES: | Cc1nc(C)c2c(n1)N(Cc1ccc(cc1)c1ccccc1c1nn[nH]n1)C(=O)CC2 |
Complexity: | 625 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 31 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 3 |
Chemical research in toxicology 20170515
PLoS computational biology 20111201
Bioorganic & medicinal chemistry 20101215
Drug metabolism and disposition: the biological fate of chemicals 20101201
Journal of medicinal chemistry 20050630
Journal of medicinal chemistry 20030605
Bioorganic & medicinal chemistry letters 20020805
Blood pressure. Supplement 20010101
The Journal of pharmacology and experimental therapeutics 20001101
Journal of medicinal chemistry 19960202