AA64102
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $8.00 | $5.00 | - + | |
5g | 98% | in stock | $15.00 | $10.00 | - + | |
10g | 98% | in stock | $28.00 | $19.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA64102 |
Chemical Name: | 2-Chloroadenosine |
CAS Number: | 146-77-0 |
Molecular Formula: | C10H12ClN5O4 |
Molecular Weight: | 301.6864 |
MDL Number: | MFCD00149351 |
SMILES: | OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1nc(Cl)nc2N |
Complexity: | 367 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 2 |
XLogP3: | -0.1 |
2-Chloroadenosine, a derivative of adenosine, is commonly utilized in chemical synthesis as a versatile building block for various processes. Due to its unique chemical structure, 2-Chloroadenosine serves as a valuable intermediate in the creation of nucleoside analogs, pharmaceuticals, and biologically active compounds. This compound's reactivity and selectivity make it an essential component in the development of novel drugs and biochemical tools. With its wide array of applications in organic chemistry, 2-Chloroadenosine plays a crucial role in advancing research and innovation within the field.