AD18640
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $9.00 | $6.00 | - + | |
250mg | 97% | in stock | $11.00 | $8.00 | - + | |
1g | 97% | in stock | $19.00 | $14.00 | - + | |
5g | 97% | in stock | $93.00 | $65.00 | - + | |
25g | 97% | in stock | $464.00 | $325.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD18640 |
Chemical Name: | Meso-tetra(4-carboxyphenyl)porphine |
CAS Number: | 14609-54-2 |
Molecular Formula: | C48H30N4O8 |
Molecular Weight: | 790.7738 |
MDL Number: | MFCD00064860 |
SMILES: | OC(=O)c1ccc(cc1)C1=C2C=CC(=N2)C(=c2ccc(=C(C3=NC(=C(c4[nH]c1cc4)c1ccc(cc1)C(=O)O)C=C3)c1ccc(cc1)C(=O)O)[nH]2)c1ccc(cc1)C(=O)O |
Complexity: | 1310 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 60 |
Hydrogen Bond Acceptor Count: | 10 |
Hydrogen Bond Donor Count: | 6 |
Rotatable Bond Count: | 8 |
XLogP3: | 8.5 |
Chemistry, an Asian journal 20100401
Antimicrobial agents and chemotherapy 20100101
Journal of virological methods 19990601
Journal of medicinal chemistry 19940415