AA64683
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $18.00 | $12.00 | - + | |
250mg | 95% | in stock | $22.00 | $15.00 | - + | |
1g | 95% | in stock | $41.00 | $29.00 | - + | |
5g | 95% | in stock | $177.00 | $124.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA64683 |
Chemical Name: | 1-(2-Aminoethyl)-1h-pyrrole-2,5-dione 2,2,2-trifluoroacetate |
CAS Number: | 146474-00-2 |
Molecular Formula: | C8H9F3N2O4 |
Molecular Weight: | 254.16326959999992 |
MDL Number: | MFCD01073617 |
SMILES: | OC(=O)C(F)(F)F.NCCN1C(=O)C=CC1=O |
Complexity: | 263 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
N-(2-Aminoethyl)maleimide trifluoroacetate, an important compound in chemical synthesis, serves a crucial role as a versatile reagent in various organic reactions. Its unique structure and properties make it a valuable tool in the creation of complex molecules and the modification of existing compounds. This compound is commonly utilized as a reagent for the modification of thiol-containing compounds, where it reacts selectively with thiol groups to form stable adducts. Additionally, N-(2-Aminoethyl)maleimide trifluoroacetate is often employed in the synthesis of peptides and proteins, where it can be used as a coupling agent for the selective modification of amino groups. Its ability to selectively target specific functional groups makes it an essential tool in the toolbox of synthetic chemists looking to design and create new molecules with precision and efficiency.