AD70505
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $356.00 | $249.00 | - + | |
1g | 98% | in stock | $869.00 | $608.00 | - + | |
5g | 98% | in stock | $4,132.00 | $2,893.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD70505 |
Chemical Name: | (2R,3S,4R,5R)-2-(Hydroxymethyl)-5-(6-methyl-9H-purin-9-yl)tetrahydrofuran-3,4-diol |
CAS Number: | 14675-48-0 |
Molecular Formula: | C11H14N4O4 |
Molecular Weight: | 266.2533 |
MDL Number: | MFCD00056009 |
SMILES: | OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1ncnc2C |
Complexity: | 334 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | -0.3 |
European journal of medicinal chemistry 20120101
Journal of medicinal chemistry 20101125
Nature chemical biology 20100501
Nucleosides, nucleotides & nucleic acids 20090501
Bioorganic & medicinal chemistry letters 20061015
The Journal of organic chemistry 20030711
Journal of medicinal chemistry 19931001