AA65832
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $10.00 | $7.00 | - + | |
250mg | 97% | in stock | $12.00 | $9.00 | - + | |
1g | 97% | in stock | $22.00 | $16.00 | - + | |
5g | 97% | in stock | $108.00 | $76.00 | - + | |
10g | 97% | in stock | $192.00 | $134.00 | - + | |
25g | 97% | in stock | $420.00 | $294.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA65832 |
Chemical Name: | Diphenyl(trifluoromethyl)sulfonium trifluoromethanesulfonate |
CAS Number: | 147531-11-1 |
Molecular Formula: | C14H10F6O3S2 |
Molecular Weight: | 404.3478 |
MDL Number: | MFCD12912173 |
SMILES: | FC(S(=O)(=O)[O-])(F)F.FC([S+](c1ccccc1)c1ccccc1)(F)F |
Complexity: | 354 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 9 |
Rotatable Bond Count: | 2 |
The application of Diphenyl(trifluoromethyl)sulfonium trifluoromethanesulfonate in chemical synthesis offers a versatile and efficient method for introducing the trifluoromethylsulfonium functional group into organic molecules. This reagent serves as a valuable precursor in various synthetic transformations, including the transfer of the trifluoromethylsulfonium moiety to nucleophiles, enabling the incorporation of the trifluoromethyl group into target compounds. Additionally, Diphenyl(trifluoromethyl)sulfonium trifluoromethanesulfonate has found utility in the synthesis of pharmaceuticals, agrochemicals, and materials due to the unique properties it imparts to the final products. Its ability to facilitate complex chemical reactions and influence the physicochemical properties of organic molecules makes it a valuable tool for organic chemists seeking to design and synthesize novel compounds with enhanced characteristics.