AA66044
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $15.00 | $10.00 | - + | |
1g | 95% | in stock | $19.00 | $13.00 | - + | |
5g | 95% | in stock | $52.00 | $36.00 | - + | |
10g | 95% | in stock | $95.00 | $67.00 | - + | |
25g | 95% | in stock | $205.00 | $143.00 | - + | |
100g | 95% | in stock | $758.00 | $531.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA66044 |
Chemical Name: | 3-Indoleglyoxylic acid |
CAS Number: | 1477-49-2 |
Molecular Formula: | C10H7NO3 |
Molecular Weight: | 189.1675 |
MDL Number: | MFCD00005625 |
SMILES: | OC(=O)C(=O)c1c[nH]c2c1cccc2 |
NSC Number: | 71954 |
Complexity: | 264 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.9 |
Marine drugs 20110101
Bioorganic & medicinal chemistry letters 20101201
Bioorganic & medicinal chemistry letters 20080101
Chemical research in toxicology 20050601
The Journal of organic chemistry 20031017
Analytical sciences : the international journal of the Japan Society for Analytical Chemistry 20030101
Bioorganic & medicinal chemistry letters 20010723