AF17519
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10mg | 98% | 2 weeks | $611.00 | $428.00 | - + | |
25mg | 98% | 2 weeks | $1,005.00 | $704.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF17519 |
Chemical Name: | 2-Hydroxy-5-[2-[4-[(3-methylpyridin-2-yl)sulfamoyl]phenyl]ethynyl]benzoic acid |
CAS Number: | 149556-49-0 |
Molecular Formula: | C21H16N2O5S |
Molecular Weight: | 408.4271 |
MDL Number: | MFCD00867572 |
SMILES: | Cc1cccnc1NS(=O)(=O)c1ccc(cc1)C#Cc1ccc(c(c1)C(=O)O)O |
Complexity: | 742 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 29 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 6 |
XLogP3: | 3.8 |
Bioorganic & medicinal chemistry letters 20111015
Journal of pharmaceutical sciences 20050701