AA74779
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $17.00 | $12.00 | - + | |
1g | 97% | in stock | $31.00 | $22.00 | - + | |
5g | 97% | in stock | $128.00 | $90.00 | - + | |
25g | 97% | in stock | $634.00 | $444.00 | - + | |
100g | 97% | in stock | $2,532.00 | $1,772.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA74779 |
Chemical Name: | L-3,3-Diphenylalanine |
CAS Number: | 149597-92-2 |
Molecular Formula: | C15H15NO2 |
Molecular Weight: | 241.2851 |
MDL Number: | MFCD01631989 |
SMILES: | N[C@@H](C(c1ccccc1)c1ccccc1)C(=O)O |
Complexity: | 250 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
Journal of medicinal chemistry 20120913
European journal of medicinal chemistry 20100901
European journal of medicinal chemistry 20090701
Journal of medicinal chemistry 20060323