AE81630
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $56.00 | $39.00 | - + | |
5mg | 95% | in stock | $158.00 | $110.00 | - + | |
10mg | 95% | in stock | $203.00 | $142.00 | - + | |
25mg | 95% | in stock | $206.00 | $144.00 | - + | |
100mg | 95% | in stock | $463.00 | $324.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE81630 |
Chemical Name: | GNE-3511 |
CAS Number: | 1496581-76-0 |
Molecular Formula: | C23H26F2N6O |
Molecular Weight: | 440.4889 |
MDL Number: | MFCD28502215 |
SMILES: | N#Cc1ccnc(c1)Nc1cc(cc(n1)N1CCC(C1)(F)F)C1CCN(CC1)C1COC1 |
Complexity: | 689 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 32 |
Hydrogen Bond Acceptor Count: | 9 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 5 |
XLogP3: | 3.2 |
Journal of medicinal chemistry 20151022
Journal of medicinal chemistry 20150108
Journal of medicinal chemistry 20070111