AA75007
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 97% | in stock | $6.00 | $4.00 | - + | |
100mg | 97% | in stock | $11.00 | $8.00 | - + | |
250mg | 95% | in stock | $14.00 | $10.00 | - + | |
1g | 95% | in stock | $52.00 | $37.00 | - + | |
5g | 95% | in stock | $255.00 | $179.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA75007 |
Chemical Name: | 4'-Bromo-2,2':6',2''-terpyridine |
CAS Number: | 149817-62-9 |
Molecular Formula: | C15H10BrN3 |
Molecular Weight: | 312.1640 |
MDL Number: | MFCD06796965 |
SMILES: | Brc1cc(nc(c1)c1ccccn1)c1ccccn1 |
Complexity: | 261 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | 3 |
Journal of the American Chemical Society 20091230