AA75116
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 95% | in stock | $27.00 | $19.00 | - + | |
25g | 95% | in stock | $67.00 | $47.00 | - + | |
100g | 95% | in stock | $101.00 | $71.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA75116 |
Chemical Name: | Diphenylphosphinic chloride |
CAS Number: | 1499-21-4 |
Molecular Formula: | C12H10ClOP |
Molecular Weight: | 236.634 |
MDL Number: | MFCD00002077 |
SMILES: | ClP(=O)(c1ccccc1)c1ccccc1 |
NSC Number: | 175848 |
Complexity: | 220 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.1 |
Journal of agricultural and food chemistry 20080326
Organic & biomolecular chemistry 20060821
The Journal of organic chemistry 20040109