AA75544
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 96% | in stock | $7.00 | $5.00 | - + | |
5g | 96% | in stock | $16.00 | $11.00 | - + | |
25g | 96% | in stock | $60.00 | $42.00 | - + | |
100g | 96% | in stock | $171.00 | $120.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA75544 |
Chemical Name: | Fmoc-2-Abz-OH |
CAS Number: | 150256-42-1 |
Molecular Formula: | C22H17NO4 |
Molecular Weight: | 359.3747 |
MDL Number: | MFCD00235883 |
SMILES: | O=C(Nc1ccccc1C(=O)O)OCC1c2ccccc2c2c1cccc2 |
Complexity: | 528 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 27 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
XLogP3: | 4.7 |
Bioorganic & medicinal chemistry letters 20101101
Journal of medicinal chemistry 20081023
Molecular pharmacology 20071101