AA76194
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $8.00 | $6.00 | - + | |
1g | 97% | in stock | $11.00 | $8.00 | - + | |
5g | 97% | in stock | $39.00 | $28.00 | - + | |
10g | 97% | in stock | $67.00 | $47.00 | - + | |
25g | >97% | in stock | $132.00 | $92.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA76194 |
Chemical Name: | D-Alloisoleucine |
CAS Number: | 1509-35-9 |
Molecular Formula: | C6H13NO2 |
Molecular Weight: | 131.1729 |
MDL Number: | MFCD00066445 |
SMILES: | CC[C@@H]([C@H](C(=O)O)N)C |
Complexity: | 103 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | -1.7 |
Amino acids 20120501
Amino acids 20120501
Marine drugs 20111201
European biophysics journal : EBJ 20110401
International journal of molecular sciences 20110101
Chemistry (Weinheim an der Bergstrasse, Germany) 20091026
Acta crystallographica. Section C, Crystal structure communications 20090601
Biopolymers 20080901
Clinical chemistry 20080301
Bioscience, biotechnology, and biochemistry 20060601
Analytical chemistry 20020701