AI36959
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $17.00 | $12.00 | - + | |
5g | 97% | in stock | $29.00 | $20.00 | - + | |
10g | 97% | in stock | $43.00 | $30.00 | - + | |
25g | 97% | in stock | $52.00 | $37.00 | - + | |
100g | 97% | in stock | $204.00 | $143.00 | - + | |
500g | 97% | in stock | $914.00 | $640.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI36959 |
Chemical Name: | (S)-4-(4-Aminobenzyl)oxazolidin-2-one |
CAS Number: | 152305-23-2 |
Molecular Formula: | C10H12N2O2 |
Molecular Weight: | 192.21448 |
MDL Number: | MFCD03411476 |
SMILES: | O=C1OC[C@@H](N1)Cc1ccc(cc1)N |
Complexity: | 212 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.1 |
Journal of pharmaceutical and biomedical analysis 20050309