AX25285
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | 2 weeks | $215.00 | $150.00 | - + | |
250mg | 95% | 2 weeks | $347.00 | $243.00 | - + | |
1g | 95% | 2 weeks | $839.00 | $588.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX25285 |
Chemical Name: | N-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)picolinamide |
CAS Number: | 1542209-30-2 |
Molecular Formula: | C18H21BN2O3 |
Molecular Weight: | 324.1819 |
MDL Number: | MFCD31916430 |
SMILES: | O=C(c1ccccn1)Nc1ccc(cc1)B1OC(C(O1)(C)C)(C)C |
Complexity: | 445 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
N-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)picolinamide is a versatile compound widely used in chemical synthesis due to its unique properties. This compound serves as an effective reagent in Suzuki-Miyaura cross-coupling reactions, facilitating the formation of carbon-carbon bonds under mild reaction conditions. Additionally, N-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)picolinamide is a valuable building block in the construction of complex organic molecules, enabling the selective introduction of functional groups at specific positions in the target compound. This compound's compatibility with various reaction conditions and its ability to streamline synthetic pathways make it a valuable tool for drug discovery, materials science, and other areas of chemical research.