AA77415
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $29.00 | $21.00 | - + | |
5g | 95% | in stock | $59.00 | $41.00 | - + | |
25g | 95% | in stock | $188.00 | $131.00 | - + | |
100g | 95% | in stock | $615.00 | $430.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA77415 |
Chemical Name: | 4,7-Dimethyl-1h-indole-2,3-dione |
CAS Number: | 15540-90-6 |
Molecular Formula: | C10H9NO2 |
Molecular Weight: | 175.184 |
MDL Number: | MFCD00047217 |
SMILES: | Cc1ccc(c2c1C(=O)C(=O)N2)C |
Complexity: | 262 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 1.4 |
Journal of medicinal chemistry 20070419