AA77780
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $8.00 | $6.00 | - + | |
250mg | 97% | in stock | $13.00 | $9.00 | - + | |
1g | 97% | in stock | $33.00 | $23.00 | - + | |
5g | 95% | in stock | $77.00 | $54.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA77780 |
Chemical Name: | L-4,4'-Biphenylalanine |
CAS Number: | 155760-02-4 |
Molecular Formula: | C15H15NO2 |
Molecular Weight: | 241.2851 |
MDL Number: | MFCD01318878 |
SMILES: | N[C@H](C(=O)O)Cc1ccc(cc1)c1ccccc1 |
Complexity: | 266 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | 0.1 |
SAR and QSAR in environmental research 20110601
PloS one 20110101
Peptides 20100701
Acta biochimica et biophysica Sinica 20080201
Bioorganic & medicinal chemistry letters 20030324
Bioorganic & medicinal chemistry letters 20021021
Journal of medicinal chemistry 20020718
Bioorganic & medicinal chemistry letters 20010723