AA78181
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $6.00 | $4.00 | - + | |
1g | 95% | in stock | $7.00 | $5.00 | - + | |
5g | 95% | in stock | $10.00 | $7.00 | - + | |
10g | 95% | in stock | $17.00 | $12.00 | - + | |
25g | 95% | in stock | $40.00 | $28.00 | - + | |
100g | 95% | in stock | $155.00 | $109.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA78181 |
Chemical Name: | 1,6,7,12-Tetrachloroperylene tetracarboxylic acid dianhydride |
CAS Number: | 156028-26-1 |
Molecular Formula: | C24H4Cl4O6 |
Molecular Weight: | 530.0970 |
MDL Number: | MFCD08056065 |
SMILES: | O=C1OC(=O)c2c3c1cc(Cl)c1c3c(c(c2)Cl)c2c3c1c(Cl)cc1c3c(cc2Cl)C(=O)OC1=O |
Complexity: | 854 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 34 |
Hydrogen Bond Acceptor Count: | 6 |
XLogP3: | 7 |
Organic letters 20121102
Analytical and bioanalytical chemistry 20110601