AE81814
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 95% | in stock | $33.00 | $23.00 | - + | |
100mg | 95% | in stock | $65.00 | $46.00 | - + | |
250mg | 95% | in stock | $128.00 | $90.00 | - + | |
1g | 95% | in stock | $317.00 | $222.00 | - + | |
5g | 95% | in stock | $950.00 | $665.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE81814 |
Chemical Name: | 3,3,3',3'-Tetramethyl-2,2',3,3'-tetrahydro-1,1'-spirobi[indene]-6,6'-diol |
CAS Number: | 1568-80-5 |
Molecular Formula: | C21H24O2 |
Molecular Weight: | 308.4141 |
MDL Number: | MFCD01412945 |
SMILES: | CC1(C)CC2(c3c1ccc(c3)O)CC(c1c2cc(O)cc1)(C)C |
Complexity: | 436 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 23 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
XLogP3: | 5.8 |
Journal of medicinal chemistry 20000518