AA81546
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $32.00 | $22.00 | - + | |
1g | 95% | in stock | $38.00 | $27.00 | - + | |
25g | 97% | in stock | $573.00 | $402.00 | - + | |
100g | 97% | in stock | $1,536.00 | $1,075.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA81546 |
Chemical Name: | 4-(2,5-Dimethyl-pyrrol-1-yl)-benzoic acid |
CAS Number: | 15898-26-7 |
Molecular Formula: | C13H13NO2 |
Molecular Weight: | 215.2478 |
MDL Number: | MFCD00453921 |
SMILES: | OC(=O)c1ccc(cc1)n1c(C)ccc1C |
Complexity: | 249 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.6 |
Journal of medicinal chemistry 20081225
Bioorganic & medicinal chemistry 20080315
Chembiochem : a European journal of chemical biology 20051001