AA81940
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 98% | in stock | $105.00 | $74.00 | - + | |
10mg | 98% | in stock | $204.00 | $143.00 | - + | |
25mg | 98% | in stock | $481.00 | $337.00 | - + | |
50mg | 98% | in stock | $850.00 | $595.00 | - + | |
100mg | 98% | in stock | $1,646.00 | $1,152.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA81940 |
Chemical Name: | Ibutamoren Mesylate |
CAS Number: | 159752-10-0 |
Molecular Formula: | C28H40N4O8S2 |
Molecular Weight: | 624.7692 |
MDL Number: | MFCD00942284 |
SMILES: | CS(=O)(=O)O.O=C([C@H](NC(=O)C(N)(C)C)COCc1ccccc1)N1CCC2(CC1)CN(c1c2cccc1)S(=O)(=O)C |
2-Amino-N-[(1R)-2-[1,2-dihydro-1-(methylsulfonyl)spiro[3H-indole-3,4'-piperidin]-1'-yl]-2-oxo-1-[(phenylmethoxy)methyl]ethyl]-2-methylpropanamide methanesulfonate is commonly used in chemical synthesis as a versatile building block for the creation of complex organic molecules. Its unique structural features make it a valuable intermediate in the development of novel pharmaceuticals and agrochemicals. This compound serves as a key component for the introduction of specific functional groups and stereochemical elements into target molecules, allowing chemists to modify and optimize their synthetic routes efficiently. By utilizing this compound in chemical synthesis, researchers can access a diverse array of molecular architectures with potential applications in drug discovery and materials science.