AA82071
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $26.00 | $18.00 | - + | |
1g | 95% | in stock | $55.00 | $38.00 | - + | |
5g | 95% | in stock | $206.00 | $144.00 | - + | |
25g | 96% | in stock | $727.00 | $509.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA82071 |
Chemical Name: | 4-(E-2-Carboxyvinyl)phenylboronic acid |
CAS Number: | 159896-15-8 |
Molecular Formula: | C9H9BO4 |
Molecular Weight: | 191.9764 |
MDL Number: | MFCD01075704 |
SMILES: | OC(=O)/C=C/c1ccc(cc1)B(O)O |
Complexity: | 219 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 3 |
Bioorganic & medicinal chemistry letters 20100601
Journal of medicinal chemistry 20020718