AA82199
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $5.00 | $4.00 | - + | |
5g | 95% | in stock | $6.00 | $5.00 | - + | |
10g | 95% | in stock | $8.00 | $6.00 | - + | |
25g | 95% | in stock | $11.00 | $8.00 | - + | |
100g | 95% | in stock | $40.00 | $28.00 | - + | |
500g | 95% | in stock | $189.00 | $133.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA82199 |
Chemical Name: | (R)-N-Boc-3-aminobutyric acid |
CAS Number: | 159991-23-8 |
Molecular Formula: | C9H17NO4 |
Molecular Weight: | 203.23558000000003 |
MDL Number: | MFCD00270343 |
SMILES: | C[C@H](CC(=O)O)NC(=O)OC(C)(C)C |
Complexity: | 219 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
XLogP3: | 0.9 |
Boc-D-3-Abu-OH is a valuable building block in chemical synthesis due to its versatility and utility in various synthetic processes. As a derivative of α-amino acids, Boc-D-3-Abu-OH plays a crucial role as a chiral intermediate in peptide synthesis and other organic reactions.One of the key applications of Boc-D-3-Abu-OH is in the synthesis of peptide-based pharmaceuticals and bioactive compounds. Its stereochemistry and chemical properties make it an ideal substrate for creating specific peptide sequences with desired biological activities. By incorporating Boc-D-3-Abu-OH into peptide synthesis, chemists can control the chirality and structural characteristics of the resulting compounds, leading to the development of novel drug candidates and research tools.Furthermore, Boc-D-3-Abu-OH can serve as a protecting group strategy in organic synthesis, shielding reactive functional groups during chemical transformations. This helps to improve the overall yield and selectivity of synthetic reactions by preventing unwanted side reactions and protecting sensitive chemical moieties. In this way, Boc-D-3-Abu-OH facilitates the efficient construction of complex molecules with high purity and structural integrity.Overall, the strategic use of Boc-D-3-Abu-OH in chemical synthesis offers chemists a powerful tool for designing and accessing diverse compounds with precise stereochemical control. Its applications extend to peptide chemistry, drug discovery, and organic synthesis, making it a valuable component in the toolkit of synthetic chemists.