AA82314
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $89.00 | $62.00 | - + | |
250mg | 98% | in stock | $128.00 | $89.00 | - + | |
1g | 98% | in stock | $263.00 | $184.00 | - + | |
5g | 98% | in stock | $696.00 | $487.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA82314 |
Chemical Name: | Indomethacin methyl ester |
CAS Number: | 1601-18-9 |
Molecular Formula: | C20H18ClNO4 |
Molecular Weight: | 371.8142 |
MDL Number: | MFCD01719291 |
SMILES: | COC(=O)Cc1c2cc(OC)ccc2n(c1C)C(=O)c1ccc(cc1)Cl |
Complexity: | 520 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 5 |
XLogP3: | 4.6 |
European journal of medicinal chemistry 20090501