AA82776
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | 1 week | $137.00 | $96.00 | - + | |
250mg | 95% | 1 week | $233.00 | $163.00 | - + | |
1g | 95% | 1 week | $626.00 | $439.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA82776 |
Chemical Name: | (S)-2-Amino-4-(2-aminophenyl)-4-oxobutanoic acid compound with sulfuric acid (1:1) |
CAS Number: | 16055-80-4 |
Molecular Formula: | C10H14N2O7S |
Molecular Weight: | 306.2924 |
MDL Number: | MFCD00039104 |
SMILES: | OS(=O)(=O)O.OC(=O)[C@H](CC(=O)c1ccccc1N)N |