AA87301
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 96% | in stock | $45.00 | $32.00 | - + | |
1g | 96% | in stock | $107.00 | $75.00 | - + | |
25g | 96% | in stock | $1,957.00 | $1,370.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA87301 |
Chemical Name: | 5-tert-Butyl-2-hydroxybenzoic acid |
CAS Number: | 16094-31-8 |
Molecular Formula: | C11H14O3 |
Molecular Weight: | 194.2271 |
MDL Number: | MFCD00156971 |
SMILES: | OC(=O)c1cc(ccc1O)C(C)(C)C |
Complexity: | 217 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 4.1 |
Journal of medicinal chemistry 20050407