AA83172
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $90.00 | $63.00 | - + | |
5g | 97 | in stock | $208.00 | $146.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA83172 |
Chemical Name: | N-Hydroxy-4-nitro-benzamidine |
CAS Number: | 1613-86-1 |
Molecular Formula: | C7H7N3O3 |
Molecular Weight: | 181.1488 |
MDL Number: | MFCD00465738 |
SMILES: | ONC(=N)c1ccc(cc1)[N+](=O)[O-] |
Complexity: | 216 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.4 |
European journal of medicinal chemistry 20101201