AA87519
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $19.00 | $13.00 | - + | |
25g | 98% | in stock | $49.00 | $34.00 | - + | |
100g | 98% | in stock | $137.00 | $96.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA87519 |
Chemical Name: | 1-Methyl-4-(4-nitrophenyl)piperazine |
CAS Number: | 16155-03-6 |
Molecular Formula: | C11H15N3O2 |
Molecular Weight: | 221.2557 |
MDL Number: | MFCD00101003 |
SMILES: | CN1CCN(CC1)c1ccc(cc1)[N+](=O)[O-] |
Complexity: | 238 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.7 |
Journal of medicinal chemistry 20011108