logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Piperazines  > Methyl 4-(piperazin-1-yl)benzoate

AA85177

163210-97-7 | Methyl 4-(piperazin-1-yl)benzoate

Packsize Purity Availability Price Discounted Price    Quantity
250mg 96% in stock $25.00 $17.00 -   +
1g 96% in stock $40.00 $28.00 -   +
5g 96% in stock $105.00 $73.00 -   +
25g 96% in stock $368.00 $257.00 -   +
100g 96% in stock $1,131.00 $792.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA85177
Chemical Name: Methyl 4-(piperazin-1-yl)benzoate
CAS Number: 163210-97-7
Molecular Formula: C12H16N2O2
Molecular Weight: 220.26764000000006
MDL Number: MFCD08234800
SMILES: COC(=O)c1ccc(cc1)N1CCNCC1

 

Computed Properties
Complexity: 231  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 16  
Hydrogen Bond Acceptor Count: 4  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 3  
XLogP3: 1  

 

 

Upstream Synthesis Route
  • The upstream synthesis of Methyl 4-(piperazin-1-yl)benzoate typically involves the following steps:
    
    1. Nitration: The synthesis begins with the nitration of methyl benzoate. This is carried out by treating methyl benzoate with a nitrating mixture typically composed of concentrated sulfuric acid and nitric acid, under cooling and stirring, to obtain methyl 4-nitrobenzoate.
    
    2. Reduction: The nitro group of methyl 4-nitrobenzoate is then reduced to an amine group. This is usually done using a reducing agent such as iron/HCl or catalytic hydrogenation to yield methyl 4-aminobenzoate.
    
    3. Diazotization: The amino compound obtained in the previous step is diazotized using sodium nitrite (NaNO2) and a mineral acid (usually HCl) at low temperatures to form a diazonium salt.
    
    4. Coupling: The diazonium salt is then treated with an excess of piperazine under basic conditions. This step typically involves the displacement of the diazonium group by the nucleophilic piperazine, leading to the formation of 4-(piperazin-1-yl)benzoic acid.
    
    5. Esterification: Finally, the carboxylic acid group of 4-(piperazin-1-yl)benzoic acid is esterified with methanol, typically in the presence of a strong acid catalyst like sulfuric acid or hydrochloric acid, to yield the desired product, Methyl 4-(piperazin-1-yl)benzoate.
    
    Throughout this synthetic route, purification steps such as recrystallization, distillation, or chromatography may be required to achieve the desired purity of intermediates and the final product.
FEATURED PRODUCTS